![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ans to R#1.cwk (WP).pdf | 09-Sep-2008 11:43 | 38K | |
| Ans to R#2.pdf | 09-Oct-2008 11:41 | 43K | |
| Ans to R#3.pdf | 27-Mar-2009 13:41 | 34K | |
| Ans to Review #4.pdf | 26-Apr-2009 12:39 | 31K | |
| Applications of Functions.pdf | 27-Jan-2009 10:53 | 35K | |
| Box With Top_Pizza Box.pdf | 16-Oct-2008 20:58 | 33K | |
| Combining Functions.pdf | 12-Feb-2009 20:37 | 65K | |
| Compound Interest.pdf | 02-Nov-2008 19:58 | 34K | |
| Data on TI-83_84.pdf | 12-Feb-2009 20:39 | 26K | |
| Directory of Graphs.pdf | 02-Sep-2008 11:12 | 55K | |
| Identifying Functions.pdf | 20-Aug-2008 11:02 | 40K | |
| Intro to Graphing.pdf | 27-Jan-2009 10:51 | 43K | |
| Modeling Problems.pdf | 20-Aug-2008 10:25 | 35K | |
| More Apps of Exps and Logs.pdf | 24-Apr-2009 07:59 | 71K | |
| Review #1.pdf | 27-Jan-2009 10:52 | 47K | |
| Review #2.pdf | 20-Feb-2009 06:26 | 56K | |
| Review #3.pdf | 27-Mar-2009 13:40 | 45K | |
| Review for Test #4.pdf | 22-Apr-2009 14:52 | 40K | |
| Roll 'em.pdf | 09-Sep-2008 12:03 | 60K | |